C19H26O10 — CID 163038754
[(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 163038754) has the molecular formula C19H26O10 and a molecular weight of 414.41 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163038754 |
| Molecular Formula | C19H26O10 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OC[C@@H](O)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C19H26O10/c1-26-13-5-2-11(3-6-13)4-7-15(22)27-9-12(21)10-28-19-18(25)17(24)16(23)14(8-20)29-19/h2-7,12,14,16-21,23-25H,8-10H2,1H3/t12-,14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | LENQPFHDGQUMMQ-KSQBTIHGSA-N |
| XLogP | -1.57 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|