C17H22O8 — CID 77395583
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 77395583) has the molecular formula C17H22O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 77395583 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(C=CC(=O)OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C17H22O8/c1-2-23-11-6-3-10(4-7-11)5-8-13(19)25-17-16(22)15(21)14(20)12(9-18)24-17/h3-8,12,14-18,20-22H,2,9H2,1H3 |
| InChIKey | VRDATCGSDLOVSK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|