C20H31NO — CID 162896064
1-pyrrolidin-1-ylhexadeca-2,7-dien-10-yn-1-one (PubChem CID 162896064) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylhexadeca-2,7-dien-10-yn-1-one.
| Compound Name | 1-pyrrolidin-1-ylhexadeca-2,7-dien-10-yn-1-one |
|---|---|
| PubChem CID | 162896064 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 1-pyrrolidin-1-ylhexadeca-2,7-dien-10-yn-1-one |
| SMILES | CCCCCC#CCC=CCCCC=CC(=O)N1CCCC1 |
| InChI | InChI=1S/C20H31NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20(22)21-18-15-16-19-21/h9-10,14,17H,2-5,8,11-13,15-16,18-19H2,1H3 |
| InChIKey | DGNHWXGTSUFJLD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|