C19H30O9 — CID 162896376
trans-(4S,5S)-4-hydroxy-3,3,5-trimethyl-4-[(E)-3-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohexan-1-one (PubChem CID 162896376) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is trans-(4S,5S)-4-hydroxy-3,3,5-trimethyl-4-[(E)-3-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohexan-1-one.
| Compound Name | trans-(4S,5S)-4-hydroxy-3,3,5-trimethyl-4-[(E)-3-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 162896376 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | trans-(4S,5S)-4-hydroxy-3,3,5-trimethyl-4-[(E)-3-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohexan-1-one |
| SMILES | C[C@H]1CC(=O)CC(C)(C)[C@@]1(O)/C=C/C(=O)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H30O9/c1-10-6-12(22)7-18(2,3)19(10,26)5-4-11(21)9-27-17-16(25)15(24)14(23)13(8-20)28-17/h4-5,10,13-17,20,23-26H,6-9H2,1-3H3/b5-4+/t10-,13+,14+,15-,16+,17+,19+/m0/s1 |
| InChIKey | JXUZZVJIZYFBAT-CDPGZDAZSA-N |
| XLogP | -1.32 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|