C17H30O7 — CID 162898413
[4,5-dihydroxy-6-(2-methylbut-2-enoxymethyl)-2-(2-methylpropoxy)oxan-3-yl] acetate (PubChem CID 162898413) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is [4,5-dihydroxy-6-(2-methylbut-2-enoxymethyl)-2-(2-methylpropoxy)oxan-3-yl] acetate.
| Compound Name | [4,5-dihydroxy-6-(2-methylbut-2-enoxymethyl)-2-(2-methylpropoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 162898413 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [4,5-dihydroxy-6-(2-methylbut-2-enoxymethyl)-2-(2-methylpropoxy)oxan-3-yl] acetate |
| SMILES | CC=C(C)COCC1OC(OCC(C)C)C(OC(C)=O)C(O)C1O |
| InChI | InChI=1S/C17H30O7/c1-6-11(4)8-21-9-13-14(19)15(20)16(23-12(5)18)17(24-13)22-7-10(2)3/h6,10,13-17,19-20H,7-9H2,1-5H3 |
| InChIKey | BLMQKSAUCLZUFD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|