C10H21NO5S2 — CID 162898599
(2S,3S,4S,5R,6S)-3-[bis(2-sulfanylethyl)amino]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 162898599) has the molecular formula C10H21NO5S2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3-[bis(2-sulfanylethyl)amino]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6S)-3-[bis(2-sulfanylethyl)amino]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 162898599 |
| Molecular Formula | C10H21NO5S2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3-[bis(2-sulfanylethyl)amino]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OC[C@@H]1O[C@H](O)[C@@H](N(CCS)CCS)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H21NO5S2/c12-5-6-8(13)9(14)7(10(15)16-6)11(1-3-17)2-4-18/h6-10,12-15,17-18H,1-5H2/t6-,7-,8-,9-,10-/m0/s1 |
| InChIKey | NZLCOSKQDKWCNA-WYCDGMCDSA-N |
| XLogP | -2.05 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|