C17H18O2 — CID 162898866
1-[(2-methylpropan-2-yl)oxy]tridec-3-en-5,7,9,11-tetrayn-2-ol (PubChem CID 162898866) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]tridec-3-en-5,7,9,11-tetrayn-2-ol.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]tridec-3-en-5,7,9,11-tetrayn-2-ol |
|---|---|
| PubChem CID | 162898866 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]tridec-3-en-5,7,9,11-tetrayn-2-ol |
| SMILES | CC#CC#CC#CC#CC=CC(O)COC(C)(C)C |
| InChI | InChI=1S/C17H18O2/c1-5-6-7-8-9-10-11-12-13-14-16(18)15-19-17(2,3)4/h13-14,16,18H,15H2,1-4H3 |
| InChIKey | LOKWUWRKBRCVCW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|