C12H14O2 — CID 102249532
(3E,9E)-dodeca-3,9-dien-5,7-diyne-2,11-diol (PubChem CID 102249532) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3E,9E)-dodeca-3,9-dien-5,7-diyne-2,11-diol.
| Compound Name | (3E,9E)-dodeca-3,9-dien-5,7-diyne-2,11-diol |
|---|---|
| PubChem CID | 102249532 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (3E,9E)-dodeca-3,9-dien-5,7-diyne-2,11-diol |
| SMILES | CC(O)/C=C/C#CC#C/C=C/C(C)O |
| InChI | InChI=1S/C12H14O2/c1-11(13)9-7-5-3-4-6-8-10-12(2)14/h7-14H,1-2H3/b9-7+,10-8+ |
| InChIKey | NDJZQUVUFMBSIE-FIFLTTCUSA-N |
| XLogP | 0.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|