C12H18O — CID 59055489
(E)-7-[(1R,2R)-2-ethylcyclopropyl]hept-3-en-5-yn-2-ol (PubChem CID 59055489) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (E)-7-[(1R,2R)-2-ethylcyclopropyl]hept-3-en-5-yn-2-ol.
| Compound Name | (E)-7-[(1R,2R)-2-ethylcyclopropyl]hept-3-en-5-yn-2-ol |
|---|---|
| PubChem CID | 59055489 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (E)-7-[(1R,2R)-2-ethylcyclopropyl]hept-3-en-5-yn-2-ol |
| SMILES | CC[C@@H]1C[C@@H]1CC#C/C=C/C(C)O |
| InChI | InChI=1S/C12H18O/c1-3-11-9-12(11)8-6-4-5-7-10(2)13/h5,7,10-13H,3,8-9H2,1-2H3/b7-5+/t10?,11-,12+/m1/s1 |
| InChIKey | AYVMDTWQLYVYNT-IJELBXRRSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|