C21H34O — CID 59125713
(E,6R)-1-[(1R,2R)-2-[(Z)-hept-2-enyl]cyclopropyl]undec-4-en-2-yn-6-ol (PubChem CID 59125713) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (E,6R)-1-[(1R,2R)-2-[(Z)-hept-2-enyl]cyclopropyl]undec-4-en-2-yn-6-ol.
| Compound Name | (E,6R)-1-[(1R,2R)-2-[(Z)-hept-2-enyl]cyclopropyl]undec-4-en-2-yn-6-ol |
|---|---|
| PubChem CID | 59125713 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (E,6R)-1-[(1R,2R)-2-[(Z)-hept-2-enyl]cyclopropyl]undec-4-en-2-yn-6-ol |
| SMILES | CCCC/C=C\C[C@H]1C[C@@H]1CC#C/C=C/[C@H](O)CCCCC |
| InChI | InChI=1S/C21H34O/c1-3-5-7-8-11-14-19-18-20(19)15-12-9-13-17-21(22)16-10-6-4-2/h8,11,13,17,19-22H,3-7,10,14-16,18H2,1-2H3/b11-8-,17-13+/t19-,20-,21+/m0/s1 |
| InChIKey | KRDIFHMEFKKWCO-SUNWSWCMSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|