C20H36O — CID 59125701
(6R,7E,9Z)-12-[(1S,2R)-2-pentylcyclopropyl]dodeca-7,9-dien-6-ol (PubChem CID 59125701) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (6R,7E,9Z)-12-[(1S,2R)-2-pentylcyclopropyl]dodeca-7,9-dien-6-ol.
| Compound Name | (6R,7E,9Z)-12-[(1S,2R)-2-pentylcyclopropyl]dodeca-7,9-dien-6-ol |
|---|---|
| PubChem CID | 59125701 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (6R,7E,9Z)-12-[(1S,2R)-2-pentylcyclopropyl]dodeca-7,9-dien-6-ol |
| SMILES | CCCCC[C@@H]1C[C@@H]1CC/C=C\C=C\[C@H](O)CCCCC |
| InChI | InChI=1S/C20H36O/c1-3-5-9-13-18-17-19(18)14-11-7-8-12-16-20(21)15-10-6-4-2/h7-8,12,16,18-21H,3-6,9-11,13-15,17H2,1-2H3/b8-7-,16-12+/t18-,19+,20-/m1/s1 |
| InChIKey | JDWLUVXQTWPAPU-ATYFMUQZSA-N |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|