C14H16O2 — CID 162890629
tetradec-6-en-8,10,12-triyne-1,5-diol (PubChem CID 162890629) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is tetradec-6-en-8,10,12-triyne-1,5-diol.
| Compound Name | tetradec-6-en-8,10,12-triyne-1,5-diol |
|---|---|
| PubChem CID | 162890629 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | tetradec-6-en-8,10,12-triyne-1,5-diol |
| SMILES | CC#CC#CC#CC=CC(O)CCCCO |
| InChI | InChI=1S/C14H16O2/c1-2-3-4-5-6-7-8-11-14(16)12-9-10-13-15/h8,11,14-16H,9-10,12-13H2,1H3 |
| InChIKey | YTTHDWIKWNORFR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|