C18H28O2 — CID 91060398
12-ethylhexadeca-6,8,10-trien-14-yne-1,5-diol (PubChem CID 91060398) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 12-ethylhexadeca-6,8,10-trien-14-yne-1,5-diol.
| Compound Name | 12-ethylhexadeca-6,8,10-trien-14-yne-1,5-diol |
|---|---|
| PubChem CID | 91060398 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 12-ethylhexadeca-6,8,10-trien-14-yne-1,5-diol |
| SMILES | CC#CCC(C=CC=CC=CC(O)CCCCO)CC |
| InChI | InChI=1S/C18H28O2/c1-3-5-12-17(4-2)13-8-6-7-9-14-18(20)15-10-11-16-19/h6-9,13-14,17-20H,4,10-12,15-16H2,1-2H3 |
| InChIKey | AMOSBEZEZQXJDI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|