C24H42N8O3 — CID 162900779
N-[3-[3-[3-[4-(diaminomethylideneamino)butylamino]propylamino]propyl-hydroxyamino]propyl]-2-(4-hydroxy-1H-indol-3-yl)acetamide (PubChem CID 162900779) has the molecular formula C24H42N8O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[3-[3-[3-[4-(diaminomethylideneamino)butylamino]propylamino]propyl-hydroxyamino]propyl]-2-(4-hydroxy-1H-indol-3-yl)acetamide.
| Compound Name | N-[3-[3-[3-[4-(diaminomethylideneamino)butylamino]propylamino]propyl-hydroxyamino]propyl]-2-(4-hydroxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 162900779 |
| Molecular Formula | C24H42N8O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.34 |
| IUPAC Name | N-[3-[3-[3-[4-(diaminomethylideneamino)butylamino]propylamino]propyl-hydroxyamino]propyl]-2-(4-hydroxy-1H-indol-3-yl)acetamide |
| SMILES | NC(N)=NCCCCNCCCNCCCN(O)CCCNC(=O)Cc1c[nH]c2cccc(O)c12 |
| InChI | InChI=1S/C24H42N8O3/c25-24(26)30-13-2-1-9-27-10-4-11-28-12-5-15-32(35)16-6-14-29-22(34)17-19-18-31-20-7-3-8-21(33)23(19)20/h3,7-8,18,27-28,31,33,35H,1-2,4-6,9-17H2,(H,29,34)(H4,25,26,30) |
| InChIKey | OYQHFBVTNBUSJT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|