C12H23NO4 — CID 162901542
(1R,2R,3R,5S,8R)-5-[(3S)-3-hydroxybutyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol (PubChem CID 162901542) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1R,2R,3R,5S,8R)-5-[(3S)-3-hydroxybutyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol.
| Compound Name | (1R,2R,3R,5S,8R)-5-[(3S)-3-hydroxybutyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 162901542 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (1R,2R,3R,5S,8R)-5-[(3S)-3-hydroxybutyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| SMILES | C[C@H](O)CC[C@@H]1CC[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)N12 |
| InChI | InChI=1S/C12H23NO4/c1-7(15)2-3-8-4-5-9-11(16)12(17)10(6-14)13(8)9/h7-12,14-17H,2-6H2,1H3/t7-,8+,9+,10+,11+,12+/m0/s1 |
| InChIKey | CGZUVSCEWJVPBT-VQJPJQAJSA-N |
| XLogP | -0.92 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |