C17H33NO — CID 102423684
(2R)-7-[(3S,5S,8R)-5-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]heptan-2-ol (PubChem CID 102423684) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is (2R)-7-[(3S,5S,8R)-5-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]heptan-2-ol.
| Compound Name | (2R)-7-[(3S,5S,8R)-5-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]heptan-2-ol |
|---|---|
| PubChem CID | 102423684 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | (2R)-7-[(3S,5S,8R)-5-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]heptan-2-ol |
| SMILES | CC(C)[C@@H]1CC[C@H]2CC[C@H](CCCCC[C@@H](C)O)N21 |
| InChI | InChI=1S/C17H33NO/c1-13(2)17-12-11-16-10-9-15(18(16)17)8-6-4-5-7-14(3)19/h13-17,19H,4-12H2,1-3H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | BEIDNAGKFGOMTP-TWMKSMIVSA-N |
| XLogP | 3.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|