C17H18O5 — CID 162901698
(6aR,8S,9R,11aR)-8,9-dimethoxy-6a,8,9,11a-tetrahydro-6H-[1]benzofuro[3,2-c]chromen-3-ol (PubChem CID 162901698) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (6aR,8S,9R,11aR)-8,9-dimethoxy-6a,8,9,11a-tetrahydro-6H-[1]benzofuro[3,2-c]chromen-3-ol.
| Compound Name | (6aR,8S,9R,11aR)-8,9-dimethoxy-6a,8,9,11a-tetrahydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
|---|---|
| PubChem CID | 162901698 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (6aR,8S,9R,11aR)-8,9-dimethoxy-6a,8,9,11a-tetrahydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
| SMILES | CO[C@H]1C=C2C(=C[C@H]1OC)O[C@H]1c3ccc(O)cc3OC[C@@H]21 |
| InChI | InChI=1S/C17H18O5/c1-19-15-6-11-12-8-21-13-5-9(18)3-4-10(13)17(12)22-14(11)7-16(15)20-2/h3-7,12,15-18H,8H2,1-2H3/t12-,15-,16+,17-/m0/s1 |
| InChIKey | PHAZBDHYCAMGFB-SJWGOKEGSA-N |
| XLogP | 2.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |