C24H40 — CID 162902156
4,9,10,13-tetramethyl-15-propan-2-yl-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 162902156) has the molecular formula C24H40 and a molecular weight of 328.58 g/mol. Its IUPAC name is 4,9,10,13-tetramethyl-15-propan-2-yl-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | 4,9,10,13-tetramethyl-15-propan-2-yl-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 162902156 |
| Molecular Formula | C24H40 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | 4,9,10,13-tetramethyl-15-propan-2-yl-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CC1=C2CCC3C4C(C(C)C)CCC4(C)CCC3(C)C2(C)CCC1 |
| InChI | InChI=1S/C24H40/c1-16(2)18-11-13-22(4)14-15-24(6)20(21(18)22)10-9-19-17(3)8-7-12-23(19,24)5/h16,18,20-21H,7-15H2,1-6H3 |
| InChIKey | KPVIZULLSJKVNJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|