C30H46O2 — CID 25209214
(1R,4R,5S,8R,16R,17R,18R)-4,5,8,19,19-pentamethyl-9-propan-2-yl-23-oxahexacyclo[16.3.2.01,17.04,16.05,13.08,12]tricos-12-en-22-one (PubChem CID 25209214) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is (1R,4R,5S,8R,16R,17R,18R)-4,5,8,19,19-pentamethyl-9-propan-2-yl-23-oxahexacyclo[16.3.2.01,17.04,16.05,13.08,12]tricos-12-en-22-one.
| Compound Name | (1R,4R,5S,8R,16R,17R,18R)-4,5,8,19,19-pentamethyl-9-propan-2-yl-23-oxahexacyclo[16.3.2.01,17.04,16.05,13.08,12]tricos-12-en-22-one |
|---|---|
| PubChem CID | 25209214 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (1R,4R,5S,8R,16R,17R,18R)-4,5,8,19,19-pentamethyl-9-propan-2-yl-23-oxahexacyclo[16.3.2.01,17.04,16.05,13.08,12]tricos-12-en-22-one |
| SMILES | CC(C)C1CCC2=C3CC[C@@H]4[C@H]5[C@H]6OC(=O)[C@@]5(CCC6(C)C)CC[C@@]4(C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C30H46O2/c1-18(2)19-8-9-20-21-10-11-22-23-24-26(3,4)12-16-30(23,25(31)32-24)17-15-29(22,7)28(21,6)14-13-27(19,20)5/h18-19,22-24H,8-17H2,1-7H3/t19?,22-,23+,24-,27-,28-,29-,30+/m1/s1 |
| InChIKey | ODBWFPVMUHVFEO-BJJUZJBPSA-N |
| XLogP | 7.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|