C35H38O8 — CID 162903924
[2-[4-[[(3R)-3-ethylheptanoyl]oxymethyl]phenyl]-5,8-dimethoxy-4-oxochromen-7-yl] 4-methylbenzoate (PubChem CID 162903924) has the molecular formula C35H38O8 and a molecular weight of 586.68 g/mol. Its IUPAC name is [2-[4-[[(3R)-3-ethylheptanoyl]oxymethyl]phenyl]-5,8-dimethoxy-4-oxochromen-7-yl] 4-methylbenzoate.
| Compound Name | [2-[4-[[(3R)-3-ethylheptanoyl]oxymethyl]phenyl]-5,8-dimethoxy-4-oxochromen-7-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 162903924 |
| Molecular Formula | C35H38O8 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | [2-[4-[[(3R)-3-ethylheptanoyl]oxymethyl]phenyl]-5,8-dimethoxy-4-oxochromen-7-yl] 4-methylbenzoate |
| SMILES | CCCC[C@@H](CC)CC(=O)OCc1ccc(-c2cc(=O)c3c(OC)cc(OC(=O)c4ccc(C)cc4)c(OC)c3o2)cc1 |
| InChI | InChI=1S/C35H38O8/c1-6-8-9-23(7-2)18-31(37)41-21-24-12-16-25(17-13-24)28-19-27(36)32-29(39-4)20-30(33(40-5)34(32)42-28)43-35(38)26-14-10-22(3)11-15-26/h10-17,19-20,23H,6-9,18,21H2,1-5H3/t23-/m1/s1 |
| InChIKey | BPRPQGSVYLIZFM-HSZRJFAPSA-N |
| XLogP | 7.65 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|