C15H24O2 — CID 162904405
(1R,2S,5R,8S)-2,8-dimethyl-5-propan-2-yl-9,10-dioxatricyclo[6.2.2.01,6]dodec-6-ene (PubChem CID 162904405) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,2S,5R,8S)-2,8-dimethyl-5-propan-2-yl-9,10-dioxatricyclo[6.2.2.01,6]dodec-6-ene.
| Compound Name | (1R,2S,5R,8S)-2,8-dimethyl-5-propan-2-yl-9,10-dioxatricyclo[6.2.2.01,6]dodec-6-ene |
|---|---|
| PubChem CID | 162904405 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,2S,5R,8S)-2,8-dimethyl-5-propan-2-yl-9,10-dioxatricyclo[6.2.2.01,6]dodec-6-ene |
| SMILES | CC(C)[C@H]1CC[C@H](C)[C@]23CC[C@@](C)(C=C12)OO3 |
| InChI | InChI=1S/C15H24O2/c1-10(2)12-6-5-11(3)15-8-7-14(4,16-17-15)9-13(12)15/h9-12H,5-8H2,1-4H3/t11-,12+,14-,15+/m0/s1 |
| InChIKey | GTTLFWBBABXFSP-MYZSUADSSA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|