C12H16O7 — CID 162906880
dimethyl (2S,3R,3aS,4R,7aS)-2-methyl-6-oxo-2,3,3a,4,5,7a-hexahydrofuro[2,3-b]pyran-3,4-dicarboxylate (PubChem CID 162906880) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is dimethyl (2S,3R,3aS,4R,7aS)-2-methyl-6-oxo-2,3,3a,4,5,7a-hexahydrofuro[2,3-b]pyran-3,4-dicarboxylate.
| Compound Name | dimethyl (2S,3R,3aS,4R,7aS)-2-methyl-6-oxo-2,3,3a,4,5,7a-hexahydrofuro[2,3-b]pyran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 162906880 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | dimethyl (2S,3R,3aS,4R,7aS)-2-methyl-6-oxo-2,3,3a,4,5,7a-hexahydrofuro[2,3-b]pyran-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@H](OC(=O)C[C@H]2C(=O)OC)O[C@H]1C |
| InChI | InChI=1S/C12H16O7/c1-5-8(11(15)17-3)9-6(10(14)16-2)4-7(13)19-12(9)18-5/h5-6,8-9,12H,4H2,1-3H3/t5-,6+,8-,9-,12-/m0/s1 |
| InChIKey | HEECBVQYJJJDSE-XUFPCMFSSA-N |
| XLogP | -0.13 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|