C24H28O8 — CID 162909595
[(1S,2S,4S,5S,6R,7R)-4-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-oxo-11,13-dioxatricyclo[5.4.2.01,6]tridec-8-en-5-yl] benzoate (PubChem CID 162909595) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is [(1S,2S,4S,5S,6R,7R)-4-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-oxo-11,13-dioxatricyclo[5.4.2.01,6]tridec-8-en-5-yl] benzoate.
| Compound Name | [(1S,2S,4S,5S,6R,7R)-4-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-oxo-11,13-dioxatricyclo[5.4.2.01,6]tridec-8-en-5-yl] benzoate |
|---|---|
| PubChem CID | 162909595 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [(1S,2S,4S,5S,6R,7R)-4-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-oxo-11,13-dioxatricyclo[5.4.2.01,6]tridec-8-en-5-yl] benzoate |
| SMILES | CC(=O)O[C@H]1C[C@](C)(O)[C@]23OC(C)(C)C=C[C@@H](OC2=O)[C@]3(C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28O8/c1-14(25)29-16-13-22(4,28)24-20(27)30-17(11-12-21(2,3)32-24)23(24,5)18(16)31-19(26)15-9-7-6-8-10-15/h6-12,16-18,28H,13H2,1-5H3/t16-,17+,18+,22-,23+,24+/m0/s1 |
| InChIKey | RSNFILCTTXAPIW-TWVANMJFSA-N |
| XLogP | 2.33 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|