C31H33F3O11 — CID 11215860
[(1S,2S,4S,5R,6R,7S,9R,12R)-5-acetyloxy-4-benzoyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate (PubChem CID 11215860) has the molecular formula C31H33F3O11 and a molecular weight of 638.59 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6R,7S,9R,12R)-5-acetyloxy-4-benzoyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate.
| Compound Name | [(1S,2S,4S,5R,6R,7S,9R,12R)-5-acetyloxy-4-benzoyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 11215860 |
| Molecular Formula | C31H33F3O11 |
| Molecular Weight | 638.59 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | [(1S,2S,4S,5R,6R,7S,9R,12R)-5-acetyloxy-4-benzoyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(=O)c2ccccc2)C[C@](C)(O)[C@]23OC(C)(C)[C@H](C[C@H](OC(=O)c4ccco4)[C@]12C)[C@H]3OC(=O)C(F)(F)F |
| InChI | InChI=1S/C31H33F3O11/c1-16(35)41-23-20(42-24(36)17-10-7-6-8-11-17)15-28(4,39)30-22(44-26(38)31(32,33)34)18(27(2,3)45-30)14-21(29(23,30)5)43-25(37)19-12-9-13-40-19/h6-13,18,20-23,39H,14-15H2,1-5H3/t18-,20+,21+,22-,23+,28+,29-,30+/m1/s1 |
| InChIKey | BVYKEKLQULWZQZ-QFADULNKSA-N |
| XLogP | 4.16 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|