C26H31F3O11 — CID 11433129
[(1S,2S,4S,5R,6R,7S,9R,12R)-4,5-diacetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate (PubChem CID 11433129) has the molecular formula C26H31F3O11 and a molecular weight of 576.52 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6R,7S,9R,12R)-4,5-diacetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate.
| Compound Name | [(1S,2S,4S,5R,6R,7S,9R,12R)-4,5-diacetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 11433129 |
| Molecular Formula | C26H31F3O11 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | [(1S,2S,4S,5R,6R,7S,9R,12R)-4,5-diacetyloxy-2-hydroxy-2,6,10,10-tetramethyl-12-(2,2,2-trifluoroacetyl)oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-2-carboxylate |
| SMILES | CC(=O)O[C@H]1C[C@](C)(O)[C@]23OC(C)(C)[C@H](C[C@H](OC(=O)c4ccco4)[C@]2(C)[C@H]1OC(C)=O)[C@H]3OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H31F3O11/c1-12(30)36-16-11-23(5,34)25-18(39-21(33)26(27,28)29)14(22(3,4)40-25)10-17(24(25,6)19(16)37-13(2)31)38-20(32)15-8-7-9-35-15/h7-9,14,16-19,34H,10-11H2,1-6H3/t14-,16+,17+,18-,19+,23+,24-,25+/m1/s1 |
| InChIKey | CCWVECXEROQWBX-LXQKFGJHSA-N |
| XLogP | 2.87 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|