C26H28O4 — CID 162909893
3-[2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-6,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 162909893) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-6,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 3-[2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-6,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 162909893 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3-[2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-6,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(C)=CCc1cc(C2CC(=O)c3c(O)cc(O)cc3C2)cc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C26H28O4/c1-15(2)5-6-16-9-18(10-17-7-8-26(3,4)30-25(16)17)19-11-20-12-21(27)14-23(29)24(20)22(28)13-19/h5,7-10,12,14,19,27,29H,6,11,13H2,1-4H3 |
| InChIKey | HQBQVBRNEMTVHN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|