C15H18O5 — CID 162913858
(4R)-5,6-dihydroxy-4,8,8-trimethyl-1,4,9,10-tetrahydropyrano[4,3-f]chromen-2-one (PubChem CID 162913858) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (4R)-5,6-dihydroxy-4,8,8-trimethyl-1,4,9,10-tetrahydropyrano[4,3-f]chromen-2-one.
| Compound Name | (4R)-5,6-dihydroxy-4,8,8-trimethyl-1,4,9,10-tetrahydropyrano[4,3-f]chromen-2-one |
|---|---|
| PubChem CID | 162913858 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (4R)-5,6-dihydroxy-4,8,8-trimethyl-1,4,9,10-tetrahydropyrano[4,3-f]chromen-2-one |
| SMILES | C[C@H]1OC(=O)Cc2c3c(c(O)c(O)c21)OC(C)(C)CC3 |
| InChI | InChI=1S/C15H18O5/c1-7-11-9(6-10(16)19-7)8-4-5-15(2,3)20-14(8)13(18)12(11)17/h7,17-18H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | KJPBBHSWGGVSHR-SSDOTTSWSA-N |
| XLogP | 2.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|