C29H24O9 — CID 162924145
4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15,18-heptaene-6,13-dione (PubChem CID 162924145) has the molecular formula C29H24O9 and a molecular weight of 516.50 g/mol. Its IUPAC name is 4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15,18-heptaene-6,13-dione.
| Compound Name | 4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15,18-heptaene-6,13-dione |
|---|---|
| PubChem CID | 162924145 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15,18-heptaene-6,13-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc1c(c2O)OC2OC(COC=CC1c1ccccc1)C(O)C(O)C2O |
| InChI | InChI=1S/C29H24O9/c30-22-16-8-4-5-9-17(16)23(31)21-19(22)12-18-15(14-6-2-1-3-7-14)10-11-36-13-20-24(32)26(34)27(35)29(37-20)38-28(18)25(21)33/h1-12,15,20,24,26-27,29,32-35H,13H2 |
| InChIKey | XDNDFEOYACRKGR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|