C25H27N3O10 — CID 162830759
2-[4,23,24,25-tetrahydroxy-9-(hydroxymethyl)-6,13-dioxo-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7(12),8,10,15-hexaen-17-yl]guanidine (PubChem CID 162830759) has the molecular formula C25H27N3O10 and a molecular weight of 529.50 g/mol. Its IUPAC name is 2-[4,23,24,25-tetrahydroxy-9-(hydroxymethyl)-6,13-dioxo-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7(12),8,10,15-hexaen-17-yl]guanidine.
| Compound Name | 2-[4,23,24,25-tetrahydroxy-9-(hydroxymethyl)-6,13-dioxo-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7(12),8,10,15-hexaen-17-yl]guanidine |
|---|---|
| PubChem CID | 162830759 |
| Molecular Formula | C25H27N3O10 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 2-[4,23,24,25-tetrahydroxy-9-(hydroxymethyl)-6,13-dioxo-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7(12),8,10,15-hexaen-17-yl]guanidine |
| SMILES | NC(N)=NC1CCOCC2OC(Oc3c1cc1c(c3O)C(=O)c3cc(CO)ccc3C1=O)C(O)C(O)C2O |
| InChI | InChI=1S/C25H27N3O10/c26-25(27)28-14-3-4-36-8-15-19(32)21(34)22(35)24(37-15)38-23-12(14)6-13-16(20(23)33)18(31)11-5-9(7-29)1-2-10(11)17(13)30/h1-2,5-6,14-15,19,21-22,24,29,32-35H,3-4,7-8H2,(H4,26,27,28) |
| InChIKey | NJIKSZHYLRKCTE-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 227.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|