C29H35N3O9 — CID 162854294
2-(4,23,24,25-tetrahydroxy-6,13-dioxo-19-pentyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaen-17-yl)guanidine (PubChem CID 162854294) has the molecular formula C29H35N3O9 and a molecular weight of 569.61 g/mol. Its IUPAC name is 2-(4,23,24,25-tetrahydroxy-6,13-dioxo-19-pentyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaen-17-yl)guanidine.
| Compound Name | 2-(4,23,24,25-tetrahydroxy-6,13-dioxo-19-pentyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaen-17-yl)guanidine |
|---|---|
| PubChem CID | 162854294 |
| Molecular Formula | C29H35N3O9 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 2-(4,23,24,25-tetrahydroxy-6,13-dioxo-19-pentyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaen-17-yl)guanidine |
| SMILES | CCCCCC1CC(N=C(N)N)c2cc3c(c(O)c2OC2OC(CO1)C(O)C(O)C2O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C29H35N3O9/c1-2-3-4-7-13-10-18(32-29(30)31)16-11-17-20(22(34)15-9-6-5-8-14(15)21(17)33)24(36)27(16)41-28-26(38)25(37)23(35)19(40-28)12-39-13/h5-6,8-9,11,13,18-19,23,25-26,28,35-38H,2-4,7,10,12H2,1H3,(H4,30,31,32) |
| InChIKey | NYDCSPCFVDNQLM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 207.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|