C20H34O10 — CID 162925122
(2R,3R,4S,5S,6R)-2-[(1Z)-2,6-dimethylhepta-1,5-dienoxy]-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 162925122) has the molecular formula C20H34O10 and a molecular weight of 434.48 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(1Z)-2,6-dimethylhepta-1,5-dienoxy]-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(1Z)-2,6-dimethylhepta-1,5-dienoxy]-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162925122 |
| Molecular Formula | C20H34O10 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1Z)-2,6-dimethylhepta-1,5-dienoxy]-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | CC(C)=CCC/C(C)=C\O[C@@H]1O[C@H](CO[C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H34O10/c1-10(2)5-4-6-11(3)7-27-20-18(26)16(24)15(23)13(30-20)9-29-19-17(25)14(22)12(21)8-28-19/h5,7,12-26H,4,6,8-9H2,1-3H3/b11-7-/t12-,13+,14-,15+,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | LZTNUPBSLSTZLA-CDXPUMSDSA-N |
| XLogP | -1.08 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|