C22H24O6 — CID 162925177
(1R,2R)-2-[(3S,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-1,2,3,8,9,10-hexahydropyrano[3,2-f]chromen-1-ol (PubChem CID 162925177) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (1R,2R)-2-[(3S,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-1,2,3,8,9,10-hexahydropyrano[3,2-f]chromen-1-ol.
| Compound Name | (1R,2R)-2-[(3S,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-1,2,3,8,9,10-hexahydropyrano[3,2-f]chromen-1-ol |
|---|---|
| PubChem CID | 162925177 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (1R,2R)-2-[(3S,4S)-4-hydroxy-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-1,2,3,8,9,10-hexahydropyrano[3,2-f]chromen-1-ol |
| SMILES | COc1ccc2c(c1)[C@@H](O)[C@@H]([C@@H]1COc3ccc4c(c3[C@@H]1O)CCCO4)CO2 |
| InChI | InChI=1S/C22H24O6/c1-25-12-4-5-18-14(9-12)21(23)15(10-27-18)16-11-28-19-7-6-17-13(3-2-8-26-17)20(19)22(16)24/h4-7,9,15-16,21-24H,2-3,8,10-11H2,1H3/t15-,16+,21-,22-/m1/s1 |
| InChIKey | AYFYREJCCXAGKG-FHTPNYMGSA-N |
| XLogP | 2.80 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |