C29H42O6 — CID 162929898
methyl 2-[2-[(3R,12S,13S)-12,13-dihydroxy-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-yl]oxy-5-hydroxyphenyl]acetate (PubChem CID 162929898) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is methyl 2-[2-[(3R,12S,13S)-12,13-dihydroxy-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-yl]oxy-5-hydroxyphenyl]acetate.
| Compound Name | methyl 2-[2-[(3R,12S,13S)-12,13-dihydroxy-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-yl]oxy-5-hydroxyphenyl]acetate |
|---|---|
| PubChem CID | 162929898 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | methyl 2-[2-[(3R,12S,13S)-12,13-dihydroxy-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-yl]oxy-5-hydroxyphenyl]acetate |
| SMILES | C=C[C@@](C)(CCC=C(C)CCC=C(C)[C@H](O)[C@@H](O)C=C(C)C)Oc1ccc(O)cc1CC(=O)OC |
| InChI | InChI=1S/C29H42O6/c1-8-29(6,35-26-15-14-24(30)18-23(26)19-27(32)34-7)16-10-12-21(4)11-9-13-22(5)28(33)25(31)17-20(2)3/h8,12-15,17-18,25,28,30-31,33H,1,9-11,16,19H2,2-7H3/t25-,28-,29-/m0/s1 |
| InChIKey | OXEKXGDCBFXSKR-FMYROPPKSA-N |
| XLogP | 5.57 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|