C39H49F3O8 — CID 25136854
[(4S,10E)-14-[4-hydroxy-2-(2-methoxy-2-oxoethyl)phenoxy]-2,6,10,14-tetramethyl-5-oxohexadeca-2,10,15-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 25136854) has the molecular formula C39H49F3O8 and a molecular weight of 702.81 g/mol. Its IUPAC name is [(4S,10E)-14-[4-hydroxy-2-(2-methoxy-2-oxoethyl)phenoxy]-2,6,10,14-tetramethyl-5-oxohexadeca-2,10,15-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(4S,10E)-14-[4-hydroxy-2-(2-methoxy-2-oxoethyl)phenoxy]-2,6,10,14-tetramethyl-5-oxohexadeca-2,10,15-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 25136854 |
| Molecular Formula | C39H49F3O8 |
| Molecular Weight | 702.81 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | [(4S,10E)-14-[4-hydroxy-2-(2-methoxy-2-oxoethyl)phenoxy]-2,6,10,14-tetramethyl-5-oxohexadeca-2,10,15-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=CC(C)(CC/C=C(\C)CCCC(C)C(=O)[C@H](C=C(C)C)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)Oc1ccc(O)cc1CC(=O)OC |
| InChI | InChI=1S/C39H49F3O8/c1-9-37(6,50-32-21-20-31(43)24-29(32)25-34(44)47-7)22-14-16-27(4)15-13-17-28(5)35(45)33(23-26(2)3)49-36(46)38(48-8,39(40,41)42)30-18-11-10-12-19-30/h9-12,16,18-21,23-24,28,33,43H,1,13-15,17,22,25H2,2-8H3/b27-16+/t28?,33-,37?,38-/m0/s1 |
| InChIKey | TXTRUWWLNLOATF-DZXIBOQZSA-N |
| XLogP | 8.52 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.81 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|