C29H37F3N2O6 — CID 50905437
[(2R,3S,6E)-3-hydroxy-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodeca-6,10-dien-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 50905437) has the molecular formula C29H37F3N2O6 and a molecular weight of 566.62 g/mol. Its IUPAC name is [(2R,3S,6E)-3-hydroxy-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodeca-6,10-dien-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R,3S,6E)-3-hydroxy-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodeca-6,10-dien-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 50905437 |
| Molecular Formula | C29H37F3N2O6 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | [(2R,3S,6E)-3-hydroxy-3,7,11-trimethyl-1-(5-nitro-1H-pyrrol-3-yl)dodeca-6,10-dien-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@H](Cc1c[nH]c([N+](=O)[O-])c1)[C@@](C)(O)CC/C=C(\C)CCC=C(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C29H37F3N2O6/c1-20(2)11-9-12-21(3)13-10-16-27(4,36)24(17-22-18-25(33-19-22)34(37)38)40-26(35)28(39-5,29(30,31)32)23-14-7-6-8-15-23/h6-8,11,13-15,18-19,24,33,36H,9-10,12,16-17H2,1-5H3/b21-13+/t24-,27+,28-/m1/s1 |
| InChIKey | AZFHEBAWAGEYPR-DJFRLSENSA-N |
| XLogP | 6.71 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|