C12H16O3 — CID 162933127
(3R,4R)-3-butyl-4-hydroxy-4,5-dihydro-3H-2-benzofuran-1-one (PubChem CID 162933127) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3R,4R)-3-butyl-4-hydroxy-4,5-dihydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,4R)-3-butyl-4-hydroxy-4,5-dihydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 162933127 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3R,4R)-3-butyl-4-hydroxy-4,5-dihydro-3H-2-benzofuran-1-one |
| SMILES | CCCC[C@H]1OC(=O)C2=C1[C@H](O)CC=C2 |
| InChI | InChI=1S/C12H16O3/c1-2-3-7-10-11-8(12(14)15-10)5-4-6-9(11)13/h4-5,9-10,13H,2-3,6-7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | BPZGLXVGANTPTC-NXEZZACHSA-N |
| XLogP | 1.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |