C20H34O — CID 162936538
(2S,6R)-2-[2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-6-ethenyl-2,6-dimethyloxane (PubChem CID 162936538) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (2S,6R)-2-[2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-6-ethenyl-2,6-dimethyloxane.
| Compound Name | (2S,6R)-2-[2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-6-ethenyl-2,6-dimethyloxane |
|---|---|
| PubChem CID | 162936538 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (2S,6R)-2-[2-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-6-ethenyl-2,6-dimethyloxane |
| SMILES | C=C[C@@]1(C)CCC[C@@](C)(CC[C@@H]2C(=C)CCCC2(C)C)O1 |
| InChI | InChI=1S/C20H34O/c1-7-19(5)13-9-14-20(6,21-19)15-11-17-16(2)10-8-12-18(17,3)4/h7,17H,1-2,8-15H2,3-6H3/t17-,19+,20+/m1/s1 |
| InChIKey | GTTWOJCJYLTUMQ-HOJAQTOUSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|