C21H30O8 — CID 162937955
3,4,5-trihydroxy-6-[(2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carbonyl]oxyoxane-2-carboxylic acid (PubChem CID 162937955) has the molecular formula C21H30O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[(2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carbonyl]oxyoxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[(2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carbonyl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162937955 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3,4,5-trihydroxy-6-[(2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carbonyl]oxyoxane-2-carboxylic acid |
| SMILES | C[C@@H]1CC[C@H]2C(C(=O)OC3OC(C(=O)O)C(O)C(O)C3O)=C[C@@H]3CC(C)(C)CC132 |
| InChI | InChI=1S/C21H30O8/c1-9-4-5-12-11(6-10-7-20(2,3)8-21(9,10)12)18(27)29-19-15(24)13(22)14(23)16(28-19)17(25)26/h6,9-10,12-16,19,22-24H,4-5,7-8H2,1-3H3,(H,25,26)/t9-,10-,12+,13?,14?,15?,16?,19?,21?/m1/s1 |
| InChIKey | BFYOGFPGIVIQCC-AYCGXETBSA-N |
| XLogP | 0.83 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |