C20H20O5 — CID 162938573
2-cyclohexa-1,5-dien-1-yl-5-hydroxy-7-methoxy-8-(3-oxobut-1-enyl)-2,3-dihydrochromen-4-one (PubChem CID 162938573) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-5-hydroxy-7-methoxy-8-(3-oxobut-1-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-5-hydroxy-7-methoxy-8-(3-oxobut-1-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162938573 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-5-hydroxy-7-methoxy-8-(3-oxobut-1-enyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(O)c2c(c1C=CC(C)=O)OC(C1=CCCC=C1)CC2=O |
| InChI | InChI=1S/C20H20O5/c1-12(21)8-9-14-18(24-2)11-16(23)19-15(22)10-17(25-20(14)19)13-6-4-3-5-7-13/h4,6-9,11,17,23H,3,5,10H2,1-2H3 |
| InChIKey | ROJIBFWBJFUCSO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|