C41H52N3O5- — CID 162941352
13-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-4-(1-pyrrol-1-id-2-ylcyclopentyl)butan-2-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol (PubChem CID 162941352) has the molecular formula C41H52N3O5- and a molecular weight of 666.88 g/mol. Its IUPAC name is 13-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-4-(1-pyrrol-1-id-2-ylcyclopentyl)butan-2-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol.
| Compound Name | 13-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-4-(1-pyrrol-1-id-2-ylcyclopentyl)butan-2-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol |
|---|---|
| PubChem CID | 162941352 |
| Molecular Formula | C41H52N3O5- |
| Molecular Weight | 666.88 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | 13-[3-[4-(2-amino-4-pyridinyl)-1-hydroxy-4-(1-pyrrol-1-id-2-ylcyclopentyl)butan-2-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol |
| SMILES | CCC1C#CC2C=CC(c3ccc(O)c(OC(CO)CC(c4ccnc(N)c4)C4(c5ccc[n-]5)CCCC4)c3)CC(O)C2C(O)CCCC1 |
| InChI | InChI=1S/C41H52N3O5/c1-2-27-8-3-4-9-35(47)40-28(12-11-27)13-14-29(22-36(40)48)30-15-16-34(46)37(23-30)49-32(26-45)25-33(31-17-21-44-39(42)24-31)41(18-5-6-19-41)38-10-7-20-43-38/h7,10,13-17,20-21,23-24,27-29,32-33,35-36,40,45-48H,2-6,8-9,18-19,22,25-26H2,1H3,(H2,42,44)/q-1 |
| InChIKey | CLEDLUDJXHYDRS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.88 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|