C33H44O11 — CID 162942306
19-[2-[2-(1,2-dihydroxyethyl)pentyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione (PubChem CID 162942306) has the molecular formula C33H44O11 and a molecular weight of 616.70 g/mol. Its IUPAC name is 19-[2-[2-(1,2-dihydroxyethyl)pentyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione.
| Compound Name | 19-[2-[2-(1,2-dihydroxyethyl)pentyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
|---|---|
| PubChem CID | 162942306 |
| Molecular Formula | C33H44O11 |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 19-[2-[2-(1,2-dihydroxyethyl)pentyl]furan-3-yl]-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
| SMILES | CCCC(Cc1occc1C1OC(=O)C2OC23C1(C)CCC1C24COC(=O)CC2OC(C)(C)C4C(=O)C(O)C13C)C(O)CO |
| InChI | InChI=1S/C33H44O11/c1-6-7-16(18(35)14-34)12-19-17(9-11-40-19)26-30(4)10-8-20-31(5,33(30)27(44-33)28(39)42-26)25(38)23(37)24-29(2,3)43-21-13-22(36)41-15-32(20,21)24/h9,11,16,18,20-21,24-27,34-35,38H,6-8,10,12-15H2,1-5H3 |
| InChIKey | GTTYBINEAIAYPC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 165.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|