C16H16O7 — CID 162949685
7-hexanoyl-4,5,6,8-tetrahydroxynaphthalene-1,2-dione (PubChem CID 162949685) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is 7-hexanoyl-4,5,6,8-tetrahydroxynaphthalene-1,2-dione.
| Compound Name | 7-hexanoyl-4,5,6,8-tetrahydroxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 162949685 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 7-hexanoyl-4,5,6,8-tetrahydroxynaphthalene-1,2-dione |
| SMILES | CCCCCC(=O)c1c(O)c(O)c2c(c1O)C(=O)C(=O)C=C2O |
| InChI | InChI=1S/C16H16O7/c1-2-3-4-5-7(17)11-14(21)12-10(15(22)16(11)23)8(18)6-9(19)13(12)20/h6,18,21-23H,2-5H2,1H3 |
| InChIKey | GIAXMYFCUBAEBV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|