C16H15ClO5 — CID 11759094
2-chloro-7-hexanoyl-6,8-dihydroxynaphthalene-1,4-dione (PubChem CID 11759094) has the molecular formula C16H15ClO5 and a molecular weight of 322.74 g/mol. Its IUPAC name is 2-chloro-7-hexanoyl-6,8-dihydroxynaphthalene-1,4-dione.
| Compound Name | 2-chloro-7-hexanoyl-6,8-dihydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11759094 |
| Molecular Formula | C16H15ClO5 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-chloro-7-hexanoyl-6,8-dihydroxynaphthalene-1,4-dione |
| SMILES | CCCCCC(=O)c1c(O)cc2c(c1O)C(=O)C(Cl)=CC2=O |
| InChI | InChI=1S/C16H15ClO5/c1-2-3-4-5-10(18)14-12(20)6-8-11(19)7-9(17)15(21)13(8)16(14)22/h6-7,20,22H,2-5H2,1H3 |
| InChIKey | ZIXDUIWGIUXKTJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|