C24H23NO8 — CID 162952850
methyl 3-(1,3-benzodioxol-5-yl)-3-[6-hydroxy-2-(morpholin-4-ylmethylidene)-3-oxo-1-benzofuran-7-yl]propanoate (PubChem CID 162952850) has the molecular formula C24H23NO8 and a molecular weight of 453.45 g/mol. Its IUPAC name is methyl 3-(1,3-benzodioxol-5-yl)-3-[6-hydroxy-2-(morpholin-4-ylmethylidene)-3-oxo-1-benzofuran-7-yl]propanoate.
| Compound Name | methyl 3-(1,3-benzodioxol-5-yl)-3-[6-hydroxy-2-(morpholin-4-ylmethylidene)-3-oxo-1-benzofuran-7-yl]propanoate |
|---|---|
| PubChem CID | 162952850 |
| Molecular Formula | C24H23NO8 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | methyl 3-(1,3-benzodioxol-5-yl)-3-[6-hydroxy-2-(morpholin-4-ylmethylidene)-3-oxo-1-benzofuran-7-yl]propanoate |
| SMILES | COC(=O)CC(c1ccc2c(c1)OCO2)c1c(O)ccc2c1OC(=CN1CCOCC1)C2=O |
| InChI | InChI=1S/C24H23NO8/c1-29-21(27)11-16(14-2-5-18-19(10-14)32-13-31-18)22-17(26)4-3-15-23(28)20(33-24(15)22)12-25-6-8-30-9-7-25/h2-5,10,12,16,26H,6-9,11,13H2,1H3 |
| InChIKey | GBLUKCAQANEAEG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_E(44)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|