C34H44O13 — CID 162954918
methyl 2-[8,9,14,18-tetraacetyloxy-6-(furan-3-yl)-12-hydroxy-7,15-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-15-yl]acetate (PubChem CID 162954918) has the molecular formula C34H44O13 and a molecular weight of 660.71 g/mol. Its IUPAC name is methyl 2-[8,9,14,18-tetraacetyloxy-6-(furan-3-yl)-12-hydroxy-7,15-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-15-yl]acetate.
| Compound Name | methyl 2-[8,9,14,18-tetraacetyloxy-6-(furan-3-yl)-12-hydroxy-7,15-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-15-yl]acetate |
|---|---|
| PubChem CID | 162954918 |
| Molecular Formula | C34H44O13 |
| Molecular Weight | 660.71 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | methyl 2-[8,9,14,18-tetraacetyloxy-6-(furan-3-yl)-12-hydroxy-7,15-dimethyl-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadecan-15-yl]acetate |
| SMILES | COC(=O)CC1(C)C(OC(C)=O)CC(O)C2C3C(OC(C)=O)C(OC(C)=O)C4(C)C(c5ccoc5)CC5OC54C3C(OC(C)=O)CC21 |
| InChI | InChI=1S/C34H44O13/c1-15(35)43-23-10-21-27(22(39)12-24(44-16(2)36)32(21,5)13-26(40)41-7)28-29(23)34-25(47-34)11-20(19-8-9-42-14-19)33(34,6)31(46-18(4)38)30(28)45-17(3)37/h8-9,14,20-25,27-31,39H,10-13H2,1-7H3 |
| InChIKey | JFMVHJYDSQWHLP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 177.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|