C22H34O5 — CID 162958584
(6,10,14-trimethyl-2,9-dioxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadecan-6-yl) acetate (PubChem CID 162958584) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (6,10,14-trimethyl-2,9-dioxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadecan-6-yl) acetate.
| Compound Name | (6,10,14-trimethyl-2,9-dioxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadecan-6-yl) acetate |
|---|---|
| PubChem CID | 162958584 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (6,10,14-trimethyl-2,9-dioxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadecan-6-yl) acetate |
| SMILES | CC(=O)OC1(C)CCC(=O)C(C)CCCC2(C)OC2C(=O)C(=C(C)C)CC1 |
| InChI | InChI=1S/C22H34O5/c1-14(2)17-9-12-21(5,26-16(4)23)13-10-18(24)15(3)8-7-11-22(6)20(27-22)19(17)25/h15,20H,7-13H2,1-6H3 |
| InChIKey | VLTIKKJYNDMBON-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|