C24H28O8 — CID 162961282
2-[[(2R)-5-heptyl-2,7-dihydroxy-4-oxo-3H-chromen-2-yl]methyl]-4,6-dihydroxybenzoic acid (PubChem CID 162961282) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[[(2R)-5-heptyl-2,7-dihydroxy-4-oxo-3H-chromen-2-yl]methyl]-4,6-dihydroxybenzoic acid.
| Compound Name | 2-[[(2R)-5-heptyl-2,7-dihydroxy-4-oxo-3H-chromen-2-yl]methyl]-4,6-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 162961282 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[[(2R)-5-heptyl-2,7-dihydroxy-4-oxo-3H-chromen-2-yl]methyl]-4,6-dihydroxybenzoic acid |
| SMILES | CCCCCCCc1cc(O)cc2c1C(=O)C[C@@](O)(Cc1cc(O)cc(O)c1C(=O)O)O2 |
| InChI | InChI=1S/C24H28O8/c1-2-3-4-5-6-7-14-8-17(26)11-20-21(14)19(28)13-24(31,32-20)12-15-9-16(25)10-18(27)22(15)23(29)30/h8-11,25-27,31H,2-7,12-13H2,1H3,(H,29,30)/t24-/m1/s1 |
| InChIKey | XXMBNHLTODQCTD-XMMPIXPASA-N |
| XLogP | 3.91 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|