C27H24O11 — CID 162962455
[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-[[(9R)-2,4,5-trihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]oxy]oxan-2-yl] benzoate (PubChem CID 162962455) has the molecular formula C27H24O11 and a molecular weight of 524.48 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-[[(9R)-2,4,5-trihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]oxy]oxan-2-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-[[(9R)-2,4,5-trihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]oxy]oxan-2-yl] benzoate |
|---|---|
| PubChem CID | 162962455 |
| Molecular Formula | C27H24O11 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-[[(9R)-2,4,5-trihydroxy-7-methyl-10-oxo-9H-anthracen-9-yl]oxy]oxan-2-yl] benzoate |
| SMILES | Cc1cc(O)c2c(c1)[C@@H](O[C@@H]1O[C@@H](OC(=O)c3ccccc3)C(O)[C@H](O)[C@H]1O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C27H24O11/c1-11-7-14-18(16(29)8-11)20(31)19-15(9-13(28)10-17(19)30)24(14)36-26-22(33)21(32)23(34)27(38-26)37-25(35)12-5-3-2-4-6-12/h2-10,21-24,26-30,32-34H,1H3/t21-,22-,23?,24-,26-,27-/m1/s1 |
| InChIKey | WVWKIPOZHVGDJJ-RPLUDGLASA-N |
| XLogP | 1.38 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |