C24H30O8 — CID 162962638
4-[3-(4-hydroxy-3,5-dimethoxyphenyl)-3a,6a-dimethyl-1,3,4,6-tetrahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol (PubChem CID 162962638) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-[3-(4-hydroxy-3,5-dimethoxyphenyl)-3a,6a-dimethyl-1,3,4,6-tetrahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol.
| Compound Name | 4-[3-(4-hydroxy-3,5-dimethoxyphenyl)-3a,6a-dimethyl-1,3,4,6-tetrahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 162962638 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[3-(4-hydroxy-3,5-dimethoxyphenyl)-3a,6a-dimethyl-1,3,4,6-tetrahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(C2OCC3(C)C(c4cc(OC)c(O)c(OC)c4)OCC23C)cc(OC)c1O |
| InChI | InChI=1S/C24H30O8/c1-23-11-31-22(14-9-17(29-5)20(26)18(10-14)30-6)24(23,2)12-32-21(23)13-7-15(27-3)19(25)16(8-13)28-4/h7-10,21-22,25-26H,11-12H2,1-6H3 |
| InChIKey | WMBGFAAYQOSHMX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |