C26H26Cl2N2O6 — CID 162963317
7-chloro-3'-[4-[(6-chloro-2-pyridinyl)oxy]piperidin-1-yl]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 162963317) has the molecular formula C26H26Cl2N2O6 and a molecular weight of 533.41 g/mol. Its IUPAC name is 7-chloro-3'-[4-[(6-chloro-2-pyridinyl)oxy]piperidin-1-yl]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | 7-chloro-3'-[4-[(6-chloro-2-pyridinyl)oxy]piperidin-1-yl]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 162963317 |
| Molecular Formula | C26H26Cl2N2O6 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 7-chloro-3'-[4-[(6-chloro-2-pyridinyl)oxy]piperidin-1-yl]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C=C(N3CCC(Oc4cccc(Cl)n4)CC3)CC1C)C2=O |
| InChI | InChI=1S/C26H26Cl2N2O6/c1-14-11-15(30-9-7-16(8-10-30)35-21-6-4-5-20(27)29-21)12-19(31)26(14)25(32)22-17(33-2)13-18(34-3)23(28)24(22)36-26/h4-6,12-14,16H,7-11H2,1-3H3 |
| InChIKey | ZXIMPZYMXOLKRX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|